CAS 2376106-42-0 appears in our catalog under these names: (2S)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 95%, (S)–2–Amino–2–(4–iodophenyl)ethan–1–ol hydrochloride, (S)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
(2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride (CAS 2376106-42-0) is a chemical compound with the molecular formula C8H11ClINO and a molecular weight of 299.53 g/mol. IUPAC name: (2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride. InChIKey: FXOQGXRQHSKXRI-DDWIOCJRSA-N.
| Molecular formula | C8H11ClINO |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride |
| InChIKey | FXOQGXRQHSKXRI-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)I.Cl |
Computed by PubChem (NCBI)