CAS 1212940-65-2 is the registry number for (2S)-2-Amino-2-(3-iodophenyl)ethan-1-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-2-(3-iodophenyl)ethanol;hydrochloride (CAS 1212940-65-2) is a chemical compound with the molecular formula C8H11ClINO and a molecular weight of 299.53 g/mol. IUPAC name: (2S)-2-amino-2-(3-iodophenyl)ethanol;hydrochloride. InChIKey: ZKHIZYOXOAPUIO-DDWIOCJRSA-N.
| Molecular formula | C8H11ClINO |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-iodophenyl)ethanol;hydrochloride |
| InChIKey | ZKHIZYOXOAPUIO-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)I)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)