Products 2829292-68-2
CAS 2829292-68-2 appears in our catalog under these names: (R)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 98%, (R)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(2R)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride (CAS 2829292-68-2) is a chemical compound with the molecular formula C8H11ClINO and a molecular weight of 299.53 g/mol. IUPAC name: (2R)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride. InChIKey: FXOQGXRQHSKXRI-QRPNPIFTSA-N.
| Molecular formula | C8H11ClINO |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride |
| InChIKey | FXOQGXRQHSKXRI-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)N)I.Cl |
Computed by PubChem (NCBI)