(S)-2-Amino-2-(naphthalen-1-yl)ethanol hydrochloride, 97%
cas: 2829292-53-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(naphthalen-1-yl)ethanol hydrochloride, 97% (CAS 2829292-53-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A155172-100mg |
| cas | 2829292-53-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 2000.19 Pln | |
| Ambeed | 5g | 6828.44 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2061.20 Pln | |
| Chemat | 5g | 7058.00 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 869.72 Pln | |
| BLDpharm | 1g | 2147.05 Pln | |
| BLDpharm | 5g | 7350.77 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-2-naphthalen-1-ylethanol;hydrochloride (CAS 2829292-53-5) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: (2S)-2-amino-2-naphthalen-1-ylethanol;hydrochloride. InChIKey: FVBAFGXQIAHFGZ-UTONKHPSSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (2S)-2-amino-2-naphthalen-1-ylethanol;hydrochloride |
| InChIKey | FVBAFGXQIAHFGZ-UTONKHPSSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-2-(naphthalen-1-yl)ethanol hydrochloride, (2S)-2-amino-2-naphthalen-1-ylethanol;hydrochloride, (S)-2-Amino-2-(naphthalen-1yl)ethanol HCl, (2S)-2-amino-2-(1-naphthyl)ethanol hydrochloride, (2S)-2-amino-2-(1-naphthyl)ethanol;hydrochloride, (S)-2-amino-2-(naphthalen-1-yl)ethan-1-ol hydrochloride