Products 1251925-26-4
CAS 1251925-26-4 is the registry number for 2-Amino-2-(naphthalen-1-yl)ethan-1-ol hydrochloride, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg.
2-amino-2-naphthalen-1-ylethanol;hydrochloride (CAS 1251925-26-4) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylethanol;hydrochloride. InChIKey: FVBAFGXQIAHFGZ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 2-amino-2-naphthalen-1-ylethanol;hydrochloride |
| InChIKey | FVBAFGXQIAHFGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(CO)N.Cl |
Computed by PubChem (NCBI)