cas: 189619-55-4 — see every product listed under this CAS number, including other names
(S)-2-Benzyl-3-((tert-butoxycarbonyl)amino)propanoic acid, 95%, 95% (CAS 189619-55-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DSR-5g |
| cas | 189619-55-4 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 6136.40 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 500mg | 952.40 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 189619-55-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZYCITKXROAFBAR-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZYCITKXROAFBAR-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)