(S)-2-Cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, 95%
cas: 2679832-44-9 — see every product listed under this CAS number, including other names
(S)-2-Cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, 95% (CAS 2679832-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1503689-100mg |
| cas | 2679832-44-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 887.69 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 875.27 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 919.49 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CAS 2679832-44-9) is a chemical compound with the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. IUPAC name: (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid. InChIKey: SELLUZIYVGEZCW-ZETCQYMHSA-N.
| Molecular formula | C10H14F3NO3 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| InChIKey | SELLUZIYVGEZCW-ZETCQYMHSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, (2S)-2-cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid, (2S)-2-cyclohexyl-2-(trifluoroacetamido)acetic acid, (S)-2-Cyclohexyl-2-(2,2,2-Trifluoroacetamido)acetic acid - [C91815], Cyclohexaneacetic acid, alpha-[(2,2,2-trifluoroacetyl)amino]-, (alphaS)-