CAS 2725791-02-4 is the registry number for 5-Azaspiro(3.5)nonan-8-one 2,2,2-trifluoroacetate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 5g.
5-azaspiro[3.5]nonan-8-one;2,2,2-trifluoroacetic acid (CAS 2725791-02-4) is a chemical compound with the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. IUPAC name: 5-azaspiro[3.5]nonan-8-one;2,2,2-trifluoroacetic acid. InChIKey: RASUKLIQWRYKRX-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO3 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 5-azaspiro[3.5]nonan-8-one;2,2,2-trifluoroacetic acid |
| InChIKey | RASUKLIQWRYKRX-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(=O)CCN2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)