CAS 2679832-44-9 is the registry number for (S)-2-Cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, 95%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
(2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CAS 2679832-44-9) is a chemical compound with the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. IUPAC name: (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid. InChIKey: SELLUZIYVGEZCW-ZETCQYMHSA-N.
| Molecular formula | C10H14F3NO3 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| InChIKey | SELLUZIYVGEZCW-ZETCQYMHSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)