CAS 1628733-95-8 appears in our catalog under these names: tert-butyl 3-(trifluoroacetyl)azetidine-1-carboxylate, 98%, tert-Butyl 3-(trifluoroacetyl)azetidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 3-(2,2,2-trifluoroacetyl)azetidine-1-carboxylate (CAS 1628733-95-8) is a chemical compound with the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. IUPAC name: tert-butyl 3-(2,2,2-trifluoroacetyl)azetidine-1-carboxylate. InChIKey: IPUIZEKVOYQPOL-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO3 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | tert-butyl 3-(2,2,2-trifluoroacetyl)azetidine-1-carboxylate |
| InChIKey | IPUIZEKVOYQPOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)