(S)-3-(1-Amino-3-hydroxypropyl)phenol hydrochloride, 95%
cas: 1212827-86-5 — see every product listed under this CAS number, including other names
(S)-3-(1-Amino-3-hydroxypropyl)phenol hydrochloride, 95% (CAS 1212827-86-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A820945-250mg |
| cas | 1212827-86-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 2695.50 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 2902.34 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1330.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[(1S)-1-amino-3-hydroxypropyl]phenol;hydrochloride (CAS 1212827-86-5) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-[(1S)-1-amino-3-hydroxypropyl]phenol;hydrochloride. InChIKey: NUBYNIGJZVNIBG-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-[(1S)-1-amino-3-hydroxypropyl]phenol;hydrochloride |
| InChIKey | NUBYNIGJZVNIBG-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@H](CCO)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-3-(1-Amino-3-hydroxypropyl)phenol hydrochloride, (S)-3-(1-Amino-3-hydroxy-propyl)-phenol hydrochloride, 3-[(1S)-1-amino-3-hydroxypropyl]phenol;hydrochloride, (S)-3-(1-Amino-3-hydroxypropyl)phenol HCl, (S)-3-(1-Amino-3-hydroxypropyl)phenolhydrochloride, 3-[(1S)-1-amino-3-hydroxy-propyl]phenol;hydrochloride