CAS 1159826-49-9 is the registry number for 3-(1-Amino-3-hydroxypropyl)phenol hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
3-(1-amino-3-hydroxypropyl)phenol;hydrochloride (CAS 1159826-49-9) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-(1-amino-3-hydroxypropyl)phenol;hydrochloride. InChIKey: NUBYNIGJZVNIBG-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-(1-amino-3-hydroxypropyl)phenol;hydrochloride |
| InChIKey | NUBYNIGJZVNIBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(CCO)N.Cl |
Computed by PubChem (NCBI)