cas: 1308256-94-1 — see every product listed under this CAS number, including other names
(S)-3-(3'-Chloro-[1,1'-biphenyl]-4-yl)-2-(((S)-1-ethoxy-1-oxopropan-2-yl)amino)propanoic acid, 98% (CAS 1308256-94-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 50mg, 10mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F498544-5MG |
| cas | 1308256-94-1 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 789.32 Pln | |
| Fluorochem | 50mg | 2955.23 Pln | |
| Fluorochem | 10mg | 1190.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3-[4-(3-chlorophenyl)phenyl]-2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]propanoic acid (CAS 1308256-94-1) is a chemical compound with the molecular formula C20H22ClNO4 and a molecular weight of 375.8 g/mol. IUPAC name: (2S)-3-[4-(3-chlorophenyl)phenyl]-2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]propanoic acid. InChIKey: PWYAUIUPDMSWJH-UGSOOPFHSA-N.
| Molecular formula | C20H22ClNO4 |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | (2S)-3-[4-(3-chlorophenyl)phenyl]-2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]propanoic acid |
| InChIKey | PWYAUIUPDMSWJH-UGSOOPFHSA-N |
| SMILES | CCOC(=O)[C@H](C)N[C@@H](CC1=CC=C(C=C1)C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)