cas: 5845-66-9 — see every product listed under this CAS number, including other names
(S)-3-(4-Hydroxybenzyl)piperazine-2,5-dione, 98%, 98% (CAS 5845-66-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AC4-50mg |
| cas | 5845-66-9 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1211.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione (CAS 5845-66-9) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: (3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione. InChIKey: QHLSAVHDWSYPEP-VIFPVBQESA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione |
| InChIKey | QHLSAVHDWSYPEP-VIFPVBQESA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)