CAS 5845-66-9 appears in our catalog under these names: (S)-3-(4-Hydroxybenzyl)piperazine-2,5-dione, 95%, Cyclo(-Gly-Tyr), >95% (HPLC), Cyclo(Gly-Tyr), Cyclo(Gly–Tyr), Cyclic(glycyl-L-tyrosyl). Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 10mg, 100mg, 0,25g, 0,1g, 0,5g.
(3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione (CAS 5845-66-9) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: (3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione. InChIKey: QHLSAVHDWSYPEP-VIFPVBQESA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3S)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione |
| InChIKey | QHLSAVHDWSYPEP-VIFPVBQESA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)