cas: 180465-02-5 — see every product listed under this CAS number, including other names
(S)-3-(Amino(carboxy)methyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 95% (CAS 180465-02-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603971-25MG |
| cas | 180465-02-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 2361.69 Pln | |
| Fluorochem | 50mg | 4413.05 Pln | |
| Fluorochem | 100mg | 7500.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[(S)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 180465-02-5) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 3-[(S)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KNSHLWJBSDBBRH-XOJFDHPMSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3-[(S)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KNSHLWJBSDBBRH-XOJFDHPMSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)