Products 78934-71-1

CAS 78934-71-1 is the registry number for Ethyl 5-(1-hydroxyethyl)-1,2-oxazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-(1-hydroxyethyl)-1,2-oxazole-3-carboxylate (CAS 78934-71-1) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: ethyl 5-(1-hydroxyethyl)-1,2-oxazole-3-carboxylate. InChIKey: USAQNLVRCXORQI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO4
Molecular weight185.18 g/mol
IUPAC nameethyl 5-(1-hydroxyethyl)-1,2-oxazole-3-carboxylate
InChIKeyUSAQNLVRCXORQI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NOC(=C1)C(C)O

Computed by PubChem (NCBI)