Products 1989824-11-4
CAS 1989824-11-4 appears in our catalog under these names: 2,6-Dimethyl-4-oxo-1,4-dihydro-3-pyridinecarboxylic acid hydrate, 95%, 2,6-Dimethyl-4-oxo-1,4-dihydro-3-pyridinecarboxylic acid hydrate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid;hydrate (CAS 1989824-11-4) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid;hydrate. InChIKey: DEAOTVCPDVOXFP-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid;hydrate |
| InChIKey | DEAOTVCPDVOXFP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)C(=O)O.O |
Computed by PubChem (NCBI)