Products 180465-05-8
CAS 180465-05-8 is the registry number for (R)–3–(Amino(carboxy)methyl)bicyclo(1·1·1)pentane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
3-[(R)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 180465-05-8) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 3-[(R)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KNSHLWJBSDBBRH-VPRNBBMASA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3-[(R)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KNSHLWJBSDBBRH-VPRNBBMASA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)