cas: 1951425-07-2 — see every product listed under this CAS number, including other names
(S)-3-Amino-1-(2,4-dichlorobenzyl)pyrrolidin-2-one hydrochloride, 97% (CAS 1951425-07-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A122129-5g |
| cas | 1951425-07-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30113.65 Pln | |
| AmBeed | 1g | 10056.34 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride (CAS 1951425-07-2) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: (3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: KKEPRDQOERKGSW-PPHPATTJSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | (3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | KKEPRDQOERKGSW-PPHPATTJSA-N |
| SMILES | C1CN(C(=O)[C@H]1N)CC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)