CAS 1951425-07-2 appears in our catalog under these names: (S)-3-Amino-1-(2,4-dichlorobenzyl) pyrrolidin-2-one hydrochloride, 95%, (S)-3-Amino-1-(2,4-dichlorobenzyl)pyrrolidin-2-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride (CAS 1951425-07-2) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: (3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: KKEPRDQOERKGSW-PPHPATTJSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | (3S)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | KKEPRDQOERKGSW-PPHPATTJSA-N |
| SMILES | C1CN(C(=O)[C@H]1N)CC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)