CAS 2270905-27-4 appears in our catalog under these names: 2-[(5-Chloroquinolin-8-yl)oxy]ethanamine dihydrochloride, 95%, 2-((5-Chloroquinolin-8-yl)oxy)ethan-1-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(5-chloroquinolin-8-yl)oxyethanamine;dihydrochloride (CAS 2270905-27-4) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: 2-(5-chloroquinolin-8-yl)oxyethanamine;dihydrochloride. InChIKey: HSDVDUOPFFSRLX-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | 2-(5-chloroquinolin-8-yl)oxyethanamine;dihydrochloride |
| InChIKey | HSDVDUOPFFSRLX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)OCCN)Cl.Cl.Cl |
Computed by PubChem (NCBI)