CAS 2221988-68-5 appears in our catalog under these names: (R)-3-Amino-1-(2,4-dichlorobenzyl) pyrrolidin-2-one hydrochloride, 95%, (R)-3-amino-1-(2,4-dichlorobenzyl) pyrrolidin-2-one hcl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride (CAS 2221988-68-5) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: (3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: KKEPRDQOERKGSW-HNCPQSOCSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | (3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | KKEPRDQOERKGSW-HNCPQSOCSA-N |
| SMILES | C1CN(C(=O)[C@@H]1N)CC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)