cas: 104530-80-5 — see every product listed under this CAS number, including other names
(S)-3-Aminotetrahydrofuran tosylate, ≥95%, ≥95% (CAS 104530-80-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1196VY-1g |
| cas | 104530-80-5 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine (CAS 104530-80-5) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine. InChIKey: BZXPLADBSZWDIH-VWMHFEHESA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine |
| InChIKey | BZXPLADBSZWDIH-VWMHFEHESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1COC[C@H]1N |
Computed by PubChem (NCBI)