CAS 1255909-25-1 appears in our catalog under these names: 1-(3,4-Dimethoxyphenyl)-2-(methylsulfonyl)ethan-1-amine, 98%, Apremilast Impurity 31, Apremilast Impurity 36. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(3,4-dimethoxyphenyl)-2-methylsulfonylethanamine (CAS 1255909-25-1) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-2-methylsulfonylethanamine. InChIKey: UGJOFOHCBMGYGY-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | UGJOFOHCBMGYGY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(CS(=O)(=O)C)N)OC |
Computed by PubChem (NCBI)