Products 73956-16-8

CAS 73956-16-8 is the registry number for 2-Diethoxymethyl-thiazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(diethoxymethyl)-1,3-thiazole-4-carboxylate (CAS 73956-16-8) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: ethyl 2-(diethoxymethyl)-1,3-thiazole-4-carboxylate. InChIKey: PPORIIMLVGSHLO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO4S
Molecular weight259.32 g/mol
IUPAC nameethyl 2-(diethoxymethyl)-1,3-thiazole-4-carboxylate
InChIKeyPPORIIMLVGSHLO-UHFFFAOYSA-N
SMILESCCOC(C1=NC(=CS1)C(=O)OCC)OCC

Computed by PubChem (NCBI)