CAS 104530-80-5 appears in our catalog under these names: (S)-3-Aminotetrahydrofuran tosylate, 95%, (S)-3-Aminotetrahydrofuran tosylate, ≥95%, ≥95%, (S)-Tetrahydrofuran-3-amine-4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine (CAS 104530-80-5) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine. InChIKey: BZXPLADBSZWDIH-VWMHFEHESA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(3S)-oxolan-3-amine |
| InChIKey | BZXPLADBSZWDIH-VWMHFEHESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1COC[C@H]1N |
Computed by PubChem (NCBI)