cas: 106498-32-2 — see every product listed under this CAS number, including other names
(S)-3-Methyl-2-phenylbutan-1-amine, 97% (CAS 106498-32-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1151747-250mg |
| cas | 106498-32-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2185.75 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 643.54 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-3-methyl-2-phenylbutan-1-amine (CAS 106498-32-2) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: (2S)-3-methyl-2-phenylbutan-1-amine. InChIKey: VDMAQVANUGNDOM-NSHDSACASA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | (2S)-3-methyl-2-phenylbutan-1-amine |
| InChIKey | VDMAQVANUGNDOM-NSHDSACASA-N |
| SMILES | CC(C)[C@H](CN)C1=CC=CC=C1 |
Computed by PubChem (NCBI)