CAS 76808-14-5 is the registry number for 1-(2,4,6-Trimethylphenyl)ethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
1-(2,4,6-trimethylphenyl)ethanamine (CAS 76808-14-5) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)ethanamine. InChIKey: LVIICDKJNNIEQG-UHFFFAOYSA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)ethanamine |
| InChIKey | LVIICDKJNNIEQG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C)N)C |
Computed by PubChem (NCBI)