CAS 67152-35-6 is the registry number for (R)-Beta-Isopropylphenethylamine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
(2R)-3-methyl-2-phenylbutan-1-amine (CAS 67152-35-6) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: (2R)-3-methyl-2-phenylbutan-1-amine. InChIKey: VDMAQVANUGNDOM-LLVKDONJSA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | (2R)-3-methyl-2-phenylbutan-1-amine |
| InChIKey | VDMAQVANUGNDOM-LLVKDONJSA-N |
| SMILES | CC(C)[C@@H](CN)C1=CC=CC=C1 |
Computed by PubChem (NCBI)