CAS 20050-15-1 appears in our catalog under these names: (1R)-1-(2,4,6-trimethylphenyl)ethan-1-amine, 95%, (R)–1–mesitylethanamine, (1R)-1-Mesitylethanamine, 95%, (R)-1-Mesitylethanamine, 97%, (R)-1-Mesitylethanamine, 95%, 95%. Offered by: Fluorochem, GLPBio, Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(2,4,6-trimethylphenyl)ethanamine (CAS 20050-15-1) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: (1R)-1-(2,4,6-trimethylphenyl)ethanamine. InChIKey: LVIICDKJNNIEQG-SNVBAGLBSA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | (1R)-1-(2,4,6-trimethylphenyl)ethanamine |
| InChIKey | LVIICDKJNNIEQG-SNVBAGLBSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@@H](C)N)C |
Computed by PubChem (NCBI)