cas: 13490-69-2 — see every product listed under this CAS number, including other names
(S)-3-Methyl-2-phenylbutanoic acid, 98% (CAS 13490-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F462993-100MG |
| cas | 13490-69-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 1034.03 Pln | |
| Fluorochem | 5g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-methyl-2-phenylbutanoic acid (CAS 13490-69-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: (2S)-3-methyl-2-phenylbutanoic acid. InChIKey: HDLQGISFYDYWFJ-JTQLQIEISA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (2S)-3-methyl-2-phenylbutanoic acid |
| InChIKey | HDLQGISFYDYWFJ-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)