(S)-3-Methyl-2-phenylbutanoic acid, 98%
cas: 13490-69-2 — see every product listed under this CAS number, including other names
(S)-3-Methyl-2-phenylbutanoic acid, 98% (CAS 13490-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A158207-100mg |
| cas | 13490-69-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 915.50 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 707.60 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 980.79 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 4131.90 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-3-methyl-2-phenylbutanoic acid (CAS 13490-69-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: (2S)-3-methyl-2-phenylbutanoic acid. InChIKey: HDLQGISFYDYWFJ-JTQLQIEISA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (2S)-3-methyl-2-phenylbutanoic acid |
| InChIKey | HDLQGISFYDYWFJ-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-3-methyl-2-phenylbutanoic acid, (2S)-3-methyl-2-phenylbutanoic acid, (alphaS)-alpha-Isopropylbenzeneacetic acid, (alphaS)-alpha-(1-Methylethyl)benzeneacetic acid, (S)-3-Methyl-2-phenylbutanoicAcid, (S)-2-Phenyl-3-methylbutanoic acid, (2S)-3-Methyl-2-phenylbutyric acid, (2S)-2-Phenyl-3-methylbutanoic acid, [S,(+)]-3-Methyl-2-phenylbutyric acid, HDLQGISFYDYWFJ-JTQLQIEISA-N