cas: 168982-69-2 — see every product listed under this CAS number, including other names
(S)-3-Oxo-N-(2-oxotetrahydrofuran-3-yl)dodecanamide, 95%, 95% (CAS 168982-69-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQA0-1mg |
| cas | 168982-69-2 |
| size | 1mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 131.60 Pln | |
| Chemat | 5mg | 237.20 Pln | |
| Chemat | 10mg | 347.60 Pln | |
| Chemat | 25mg | 563.60 Pln | |
| Chemat | 50mg | 1067.60 Pln | |
| Chemat | 100mg | 1946.00 Pln | |
| Chemat | 250mg | 2325.20 Pln | |
| Chemat | 1g | 7624.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(3-oxododecanoyl)-L-homoserine lactone is an N-acyl-L-homoserine lactone having 3-oxododecanoyl as the acyl substituent. It has a role as a bacterial metabolite. It is a N-(3-oxododecanoyl)homoserine lactone and a N-acyl-L-homoserine lactone. It is an enantiomer of a N-(3-oxododecanoyl)-D-homoserine lactone.
Source: ChEBI
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]dodecanamide |
| InChIKey | PHSRRHGYXQCRPU-AWEZNQCLSA-N |
| SMILES | CCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
Computed by PubChem (NCBI)