cas: 270063-45-1 — see every product listed under this CAS number, including other names
(S)-4-(Benzo[b]thiophen-3-yl)-3-((tert-butoxycarbonyl)amino)butanoic acid, 98% (CAS 270063-45-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692206-100MG |
| cas | 270063-45-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 435.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270063-45-1) is a chemical compound with the molecular formula C17H21NO4S and a molecular weight of 335.4 g/mol. IUPAC name: (3S)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VRUFHPBCNHYEPJ-LBPRGKRZSA-N.
| Molecular formula | C17H21NO4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (3S)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VRUFHPBCNHYEPJ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CSC2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)