(S)-4-(Pyrrolidin-2-yl)benzoic acid hydrochloride, 95% HPLC
cas: 1381927-91-8 — see every product listed under this CAS number, including other names
(S)-4-(Pyrrolidin-2-yl)benzoic acid hydrochloride, 95% HPLC (CAS 1381927-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F868447-100MG |
| cas | 1381927-91-8 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 778.91 Pln | |
| Fluorochem | 250mg | 1492.20 Pln | |
| Fluorochem | 1g | 3928.84 Pln | |
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 1110.19 Pln | |
| Ambeed | 1g | 2773.38 Pln | |
| Chemat | 50mg | 414.80 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 500mg | 1686.80 Pln | |
| Chemat | 1g | 2330.00 Pln |
properties
| purity | 95% HPLC |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride (CAS 1381927-91-8) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 4-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride. InChIKey: CZPDODVKXJRKDO-PPHPATTJSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 4-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride |
| InChIKey | CZPDODVKXJRKDO-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)