(S)-4-(tert-Butoxycarbonyl)piperazine-2-carboxylic acid 97%
cas: 848482-93-9 — see every product listed under this CAS number, including other names
(S)-4-(tert-Butoxycarbonyl)piperazine-2-carboxylic acid 97% (CAS 848482-93-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175247-500g |
| cas | 848482-93-9 |
| size | 500g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 23260.06 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 10g | 654.06 Pln | |
| Ambeed | 25g | 1521.81 Pln | |
| Ambeed | 100g | 5866.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175247 |
(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 848482-93-9) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: YRYAXQJXMBETAT-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | YRYAXQJXMBETAT-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(s)-1-boc-piperazine-3-carboxylic acid, (s)-4-(tert-butoxycarbonyl)piperazine-2-carboxylic acid, (S)-4-Boc-Piperazine-2-carboxylic acid, 1,3-Piperazinedicarboxylicacid, 1-(1,1-dimethylethyl) ester, (3S)-, (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid, (2S)-4-tert-butoxycarbonylpiperazine-2-carboxylic acid, (S)-1-N-Boc-piperazine-3-carboxylic acid, (s)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester, 1,3-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) ester, (3S)-, s-bpca