cas: 848482-93-9 — see every product listed under this CAS number, including other names
(S)-4-N-Boc-Piperazine-2-carboxylic acid, 97% (CAS 848482-93-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034387-1G |
| cas | 848482-93-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1388.07 Pln | |
| Fluorochem | 100g | 4662.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 848482-93-9) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: YRYAXQJXMBETAT-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | YRYAXQJXMBETAT-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)