(S)-4-(tert-Butyl)-2-(5-chloropyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee
cas: 2757083-20-6 — see every product listed under this CAS number, including other names
(S)-4-(tert-Butyl)-2-(5-chloropyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee (CAS 2757083-20-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Fluorochem, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1493895-250mg |
| cas | 2757083-20-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1327.12 Pln | |
| Ambeed | 1g | 3090.44 Pln | |
| Fluorochem | 1g | 6589.36 Pln | |
| Chemat | 100mg | 789.20 Pln | |
| Chemat | 250mg | 1293.20 Pln | |
| Chemat | 1g | 3621.20 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1430.63 Pln | |
| BLDpharm | 1g | 3329.96 Pln | |
| Fluorochem | 100mg | 1460.96 Pln | |
| Fluorochem | 250mg | 2398.13 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2757083-20-6) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: (4S)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: JFAYSLQIISQWOE-SNVBAGLBSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (4S)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | JFAYSLQIISQWOE-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)