cas: 17015-15-5 — see every product listed under this CAS number, including other names
(S)-4-Acetamido-5-methoxy-5-oxopentanoic acid, 97% (CAS 17015-15-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A344827-25g |
| cas | 17015-15-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 14287.84 Pln | |
| AmBeed | 10g | 7178.92 Pln | |
| AmBeed | 5g | 4640.02 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4S)-4-acetamido-5-methoxy-5-oxopentanoic acid (CAS 17015-15-5) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid. InChIKey: XDCCXFLKDREFMO-LURJTMIESA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid |
| InChIKey | XDCCXFLKDREFMO-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)