CAS 2412583-29-8 is the registry number for (2R,6R)-4-(Methoxycarbonyl)-6-methylmorpholine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,6R)-4-methoxycarbonyl-6-methylmorpholine-2-carboxylic acid (CAS 2412583-29-8) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: (2R,6R)-4-methoxycarbonyl-6-methylmorpholine-2-carboxylic acid. InChIKey: SCCXMDOLSZJZQD-PHDIDXHHSA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (2R,6R)-4-methoxycarbonyl-6-methylmorpholine-2-carboxylic acid |
| InChIKey | SCCXMDOLSZJZQD-PHDIDXHHSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C(=O)O)C(=O)OC |
Computed by PubChem (NCBI)