Products 1433363-32-6
CAS 1433363-32-6 is the registry number for 2-Oxa-5-azaspiro[3.4]octane xoxalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxa-5-azaspiro[3.4]octane;oxalic acid (CAS 1433363-32-6) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: 2-oxa-5-azaspiro[3.4]octane;oxalic acid. InChIKey: JFOZNINEJYPQQK-UHFFFAOYSA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-oxa-5-azaspiro[3.4]octane;oxalic acid |
| InChIKey | JFOZNINEJYPQQK-UHFFFAOYSA-N |
| SMILES | C1CC2(COC2)NC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Oxa-5-azaspiro(3.4)octane oxalate, 2-oxa-5-azaspiro[3.4]octane;oxalic acid, 2-Oxa-5-azaspiro[3.4]octane oxalate salt, 2-Oxa-5-azaspiro[3.4]octane xoxalate, JFOZNINEJYPQQK-UHFFFAOYSA-N, 2-Oxa-5-azaspiro[3.4]octanexoxalate, 2-Oxa-5-aza-spiro[3.4]octane oxalate, 2-Oxa-5-azaspiro[3.4]octane oxalic acid, 2-oxa-8-azaspiro[3.4]octane; oxalic acid