Products 17015-15-5
CAS 17015-15-5 appears in our catalog under these names: (S)-4-Acetamido-5-methoxy-5-oxopentanoic acid, 97%, (S)-4-Acetamido-5-methoxy-5-oxopentanoic acid, 95%, Ac-glu-ome, 95%, Ac-Glu-OMe, >95% (HPLC), Ac–Glu–OMe. Offered by: AmBeed, Fluorochem, Combi-blocks, TRC, GLPBio. Available pack sizes: 25g, 10g, 5g, 250mg, 1g, 100mg, 10mg, 50mg.
(4S)-4-acetamido-5-methoxy-5-oxopentanoic acid (CAS 17015-15-5) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid. InChIKey: XDCCXFLKDREFMO-LURJTMIESA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid |
| InChIKey | XDCCXFLKDREFMO-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Ac-glu-ome, (S)-4-Acetamido-5-methoxy-5-oxopentanoic acid, (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid, Acetyl-L-glutamic acid alpha-methyl ester, AC-GLUTAMIC ACID-OME, N-alpha-Acetyl-L-glutamic acid alpha-methyl ester, (4S)-4-acetamido-5-methoxy-5-oxo-pentanoic Acid, N-Acetyl-L-glutamic acid methyl ester, N-Acetyl-L-glutamic acid 1-methyl ester, Acetyl-L-glutamic acid alpha-methyl ester>/= 95% (NMR)