cas: 104266-90-2 — see every product listed under this CAS number, including other names
(S)-4-Benzyl-3-(3-methylbutanoyl)oxazolidin-2-one, 98%, 98% (CAS 104266-90-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11975N-100mg |
| cas | 104266-90-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 69.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 25g | 1024.40 Pln | |
| Chemat | 10g | 453.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one (CAS 104266-90-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one. InChIKey: JHGXEUXQJIKZMY-ZDUSSCGKSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one |
| InChIKey | JHGXEUXQJIKZMY-ZDUSSCGKSA-N |
| SMILES | CC(C)CC(=O)N1[C@H](COC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)