cas: 104266-90-2 — see every product listed under this CAS number, including other names
(S)-4-Benzyl-3-(3-methylbutanoyl)oxazolidin-2-one, 98% (CAS 104266-90-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227360-1G |
| cas | 104266-90-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 2.5g | 294.71 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 581.06 Pln | |
| Fluorochem | 25g | 1372.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one (CAS 104266-90-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one. InChIKey: JHGXEUXQJIKZMY-ZDUSSCGKSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (4S)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one |
| InChIKey | JHGXEUXQJIKZMY-ZDUSSCGKSA-N |
| SMILES | CC(C)CC(=O)N1[C@H](COC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)