cas: 714971-28-5 — see every product listed under this CAS number, including other names
(S)-4-Boc-(3-hydroxymethyl)morpholine 97% (CAS 714971-28-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132484-500g |
| cas | 714971-28-5 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 13269.81 Pln | |
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 10g | 565.06 Pln | |
| Ambeed | 25g | 1065.69 Pln | |
| Ambeed | 100g | 3368.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132484 |
Tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate (CAS 714971-28-5) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate. InChIKey: AIQSXVGBMCJQAG-QMMMGPOBSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate |
| InChIKey | AIQSXVGBMCJQAG-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1CO |
Computed by PubChem (NCBI)