cas: 1391419-55-8 — see every product listed under this CAS number, including other names
(S)-4-Methoxy-3-(pyrrolidin-2-yl)benzoic acid hydrochloride, 95%, 95% (CAS 1391419-55-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDNG-250mg |
| cas | 1391419-55-8 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 2008.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-3-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride (CAS 1391419-55-8) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 4-methoxy-3-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride. InChIKey: NXZFTRFYMBKBGP-PPHPATTJSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 4-methoxy-3-[(2S)-pyrrolidin-2-yl]benzoic acid;hydrochloride |
| InChIKey | NXZFTRFYMBKBGP-PPHPATTJSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)[C@@H]2CCCN2.Cl |
Computed by PubChem (NCBI)