CAS 1330750-51-0 is the registry number for (+/-)-Trans-4-(2-methoxy-phenyl)-pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3R,4S)-4-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1330750-51-0) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: (3R,4S)-4-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: OAUHQXKTEUYPFQ-UXQCFNEQSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | (3R,4S)-4-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | OAUHQXKTEUYPFQ-UXQCFNEQSA-N |
| SMILES | COC1=CC=CC=C1[C@H]2CNC[C@@H]2C(=O)O.Cl |
Computed by PubChem (NCBI)