CAS 128019-59-0 appears in our catalog under these names: 4–Boc–piperazine–2–carboxylic acid, N-4-Boc-2-piperazine carboxylic acid, 4-(tert-Butoxycarbonyl)piperazine-2-carboxylic acid 97%, 4-BOC-PIPERAZINE-2-CARBOXYLIC ACID, 96%, N-4-Boc-2-piperazinecarboxylic acid, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 250mg, 1g.
4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 128019-59-0) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: YRYAXQJXMBETAT-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | YRYAXQJXMBETAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C(=O)O |
Computed by PubChem (NCBI)