cas: 281655-37-6 — see every product listed under this CAS number, including other names
(S)-4-N-Fmoc-3-morpholinecarboxylic acid, 97% (CAS 281655-37-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494214-100MG |
| cas | 281655-37-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 1424.52 Pln | |
| Fluorochem | 10g | 2793.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid (CAS 281655-37-6) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid. InChIKey: CJVIYWXADATNKP-SFHVURJKSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid |
| InChIKey | CJVIYWXADATNKP-SFHVURJKSA-N |
| SMILES | C1COC[C@H](N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)