CAS 942153-03-9 appears in our catalog under these names: 4-Fmoc-3(R)-morpholinecarboxylic Acid, (R)–4–(((9H–Fluoren–9–yl)methoxy)carbonyl)morpholine–3–carboxylic acid, (3R)-4-{((9H-fluoren-9-yl)methoxy)carbonyl}morpholine-3-carboxylic acid, (R)-Fmoc-3-carboxymorpholine 97%, (R)-4-(((9H-Fluoren-9-yl)methoxy)carbonyl)morpholine-3-carboxylic acid, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 500mg, 250mg, 0,5g, 5g, 10g, 25g.
(3R)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid (CAS 942153-03-9) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (3R)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid. InChIKey: CJVIYWXADATNKP-GOSISDBHSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (3R)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid |
| InChIKey | CJVIYWXADATNKP-GOSISDBHSA-N |
| SMILES | C1COC[C@@H](N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)